C17H30O2Si — CID 10957376
(8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one (PubChem CID 10957376) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one.
| Compound Name | (8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one |
|---|---|
| PubChem CID | 10957376 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one |
| SMILES | CC1=C2C(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC1 |
| InChI | InChI=1S/C17H30O2Si/c1-12-10-11-13-15(9-7-8-14(18)16(12)13)19-20(5,6)17(2,3)4/h13,15H,7-11H2,1-6H3/t13-,15-/m0/s1 |
| InChIKey | HDAPYFPVXJSVSZ-ZFWWWQNUSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|