About tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane
tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane (PubChem CID 10957377) has the molecular formula C18H34OSi
and a molecular weight of 294.56 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane |
| PubChem CID | 10957377 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane |
| SMILES | CC1=C2CCC[C@](C)(O[Si](C)(C)C(C)(C)C)[C@H](CC1)C2 |
| InChI | InChI=1S/C18H34OSi/c1-14-10-11-16-13-15(14)9-8-12-18(16,5)19-20(6,7)17(2,3)4/h16H,8-13H2,1-7H3/t16-,18+/m1/s1 |
| InChIKey | IZZZGBYXOKJENL-AEFFLSMTSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane (CID 10957377) is tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane is CC1=C2CCC[C@](C)(O[Si](C)(C)C(C)(C)C)[C@H](CC1)C2.
What is the InChIKey of tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane?
The InChIKey is IZZZGBYXOKJENL-AEFFLSMTSA-N. The full InChI is InChI=1S/C18H34OSi/c1-14-10-11-16-13-15(14)9-8-12-18(16,5)19-20(6,7)17(2,3)4/h16H,8-13H2,1-7H3/t16-,18+/m1/s1.
What are the key properties of tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane?
tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane has a molecular weight of 294.56 g/mol, XLogP of 6.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[(1R,2S)-2,7-dimethyl-2-bicyclo[4.3.1]dec-6-enyl]oxy]-dimethylsilane is sourced from PubChem (CID 10957377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).