About [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene
[(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene (PubChem CID 10957825) has the molecular formula C18H28O2S
and a molecular weight of 308.49 g/mol. Its IUPAC name is [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene.
Molecular Properties
| Compound Name | [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene |
| PubChem CID | 10957825 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene |
| SMILES | CCCC/C(=C\C(C)(C)C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O2S/c1-5-6-10-16(15-18(2,3)4)13-14-21(19,20)17-11-8-7-9-12-17/h7-9,11-12,15H,5-6,10,13-14H2,1-4H3/b16-15+ |
| InChIKey | XJXKRRLINVXTDC-FOCLMDBBSA-N |
| XLogP | 5.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene?
The IUPAC name of [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene (CID 10957825) is [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene.
What is the SMILES notation for [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene?
The canonical SMILES for [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene is CCCC/C(=C\C(C)(C)C)CCS(=O)(=O)c1ccccc1.
What is the InChIKey of [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene?
The InChIKey is XJXKRRLINVXTDC-FOCLMDBBSA-N. The full InChI is InChI=1S/C18H28O2S/c1-5-6-10-16(15-18(2,3)4)13-14-21(19,20)17-11-8-7-9-12-17/h7-9,11-12,15H,5-6,10,13-14H2,1-4H3/b16-15+.
What are the key properties of [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene?
[(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene has a molecular weight of 308.49 g/mol, XLogP of 5.01, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene is sourced from PubChem (CID 10957825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).