C18H28O2S — CID 10957825
[(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene (PubChem CID 10957825) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene.
| Compound Name | [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene |
|---|---|
| PubChem CID | 10957825 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [(3E)-3-(2,2-dimethylpropylidene)heptyl]sulfonylbenzene |
| SMILES | CCCC/C(=C\C(C)(C)C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O2S/c1-5-6-10-16(15-18(2,3)4)13-14-21(19,20)17-11-8-7-9-12-17/h7-9,11-12,15H,5-6,10,13-14H2,1-4H3/b16-15+ |
| InChIKey | XJXKRRLINVXTDC-FOCLMDBBSA-N |
| XLogP | 5.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|