C16H28O4Si — CID 10957943
(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3,3-dimethyl-2-oxocyclobutyl]oxolan-2-one (PubChem CID 10957943) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3,3-dimethyl-2-oxocyclobutyl]oxolan-2-one.
| Compound Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3,3-dimethyl-2-oxocyclobutyl]oxolan-2-one |
|---|---|
| PubChem CID | 10957943 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(1S)-3,3-dimethyl-2-oxocyclobutyl]oxolan-2-one |
| SMILES | CC1(C)C[C@@H]([C@H]2C(=O)OC[C@H]2O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H28O4Si/c1-15(2,3)21(6,7)20-11-9-19-14(18)12(11)10-8-16(4,5)13(10)17/h10-12H,8-9H2,1-7H3/t10-,11+,12+/m0/s1 |
| InChIKey | GCBWONUSWMVRSY-QJPTWQEYSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|