C16H26O6 — CID 10957990
ethyl 2-[(2S,4aS,6R,8R,8aR)-2,6-diethoxy-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-8-yl]acetate (PubChem CID 10957990) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl 2-[(2S,4aS,6R,8R,8aR)-2,6-diethoxy-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-8-yl]acetate.
| Compound Name | ethyl 2-[(2S,4aS,6R,8R,8aR)-2,6-diethoxy-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-8-yl]acetate |
|---|---|
| PubChem CID | 10957990 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | ethyl 2-[(2S,4aS,6R,8R,8aR)-2,6-diethoxy-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-8-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@H](OCC)O[C@H]2C=C[C@@H](OCC)O[C@H]12 |
| InChI | InChI=1S/C16H26O6/c1-4-18-13(17)9-11-10-15(20-6-3)21-12-7-8-14(19-5-2)22-16(11)12/h7-8,11-12,14-16H,4-6,9-10H2,1-3H3/t11-,12-,14-,15+,16+/m0/s1 |
| InChIKey | XOYWNTBHSCHQQB-RHMLRGBNSA-N |
| XLogP | 2.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|