C20H28O3 — CID 10958067
(1R,3aS,6R,6aS)-6-hydroxy-1-[(1Z,4Z,7Z,10Z)-trideca-1,4,7,10-tetraenyl]-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (PubChem CID 10958067) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,3aS,6R,6aS)-6-hydroxy-1-[(1Z,4Z,7Z,10Z)-trideca-1,4,7,10-tetraenyl]-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
| Compound Name | (1R,3aS,6R,6aS)-6-hydroxy-1-[(1Z,4Z,7Z,10Z)-trideca-1,4,7,10-tetraenyl]-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 10958067 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,3aS,6R,6aS)-6-hydroxy-1-[(1Z,4Z,7Z,10Z)-trideca-1,4,7,10-tetraenyl]-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\[C@H]1OC(=O)[C@H]2CC[C@@H](O)[C@H]21 |
| InChI | InChI=1S/C20H28O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-19-16(20(22)23-18)14-15-17(19)21/h3-4,6-7,9-10,12-13,16-19,21H,2,5,8,11,14-15H2,1H3/b4-3-,7-6-,10-9-,13-12-/t16-,17+,18+,19-/m0/s1 |
| InChIKey | MUYSCJDPOFJXIF-DJZAIGHLSA-N |
| XLogP | 4.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|