C21H23NO2 — CID 10958221
benzyl 2-[[(1R)-1-phenylethyl]amino]cyclopentene-1-carboxylate (PubChem CID 10958221) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is benzyl 2-[[(1R)-1-phenylethyl]amino]cyclopentene-1-carboxylate.
| Compound Name | benzyl 2-[[(1R)-1-phenylethyl]amino]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 10958221 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | benzyl 2-[[(1R)-1-phenylethyl]amino]cyclopentene-1-carboxylate |
| SMILES | C[C@@H](NC1=C(C(=O)OCc2ccccc2)CCC1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-16(18-11-6-3-7-12-18)22-20-14-8-13-19(20)21(23)24-15-17-9-4-2-5-10-17/h2-7,9-12,16,22H,8,13-15H2,1H3/t16-/m1/s1 |
| InChIKey | XEINCMMNGUPYFT-MRXNPFEDSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |