C17H26O6 — CID 10958353
[(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-5,8-dihydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-4-yl] acetate (PubChem CID 10958353) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-5,8-dihydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-4-yl] acetate.
| Compound Name | [(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-5,8-dihydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-4-yl] acetate |
|---|---|
| PubChem CID | 10958353 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-5,8-dihydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2[C@H](C[C@@]3(C)[C@H](O)CC[C@@](C)(O)[C@H]13)OC(=O)[C@@H]2C |
| InChI | InChI=1S/C17H26O6/c1-8-12-10(23-15(8)20)7-16(3)11(19)5-6-17(4,21)14(16)13(12)22-9(2)18/h8,10-14,19,21H,5-7H2,1-4H3/t8-,10+,11-,12-,13+,14-,16+,17-/m1/s1 |
| InChIKey | UBTQDHGVDNEFLI-HWAIOWLJSA-N |
| XLogP | 1.03 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |