C21H17N3O — CID 10958392
2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenol (PubChem CID 10958392) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenol.
| Compound Name | 2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenol |
|---|---|
| PubChem CID | 10958392 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenol |
| SMILES | Cc1nnc(-c2ccc(-c3ccccc3)cc2)n1-c1ccccc1O |
| InChI | InChI=1S/C21H17N3O/c1-15-22-23-21(24(15)19-9-5-6-10-20(19)25)18-13-11-17(12-14-18)16-7-3-2-4-8-16/h2-14,25H,1H3 |
| InChIKey | NLIFUYBSDQHKCX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |