C20H24O4 — CID 10958419
methyl 3-[(1S,5S,9S,10S)-5-methyl-2-oxo-15-oxatetracyclo[7.5.2.01,10.05,10]hexadeca-3,7,12-trien-14-yl]propanoate (PubChem CID 10958419) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl 3-[(1S,5S,9S,10S)-5-methyl-2-oxo-15-oxatetracyclo[7.5.2.01,10.05,10]hexadeca-3,7,12-trien-14-yl]propanoate.
| Compound Name | methyl 3-[(1S,5S,9S,10S)-5-methyl-2-oxo-15-oxatetracyclo[7.5.2.01,10.05,10]hexadeca-3,7,12-trien-14-yl]propanoate |
|---|---|
| PubChem CID | 10958419 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | methyl 3-[(1S,5S,9S,10S)-5-methyl-2-oxo-15-oxatetracyclo[7.5.2.01,10.05,10]hexadeca-3,7,12-trien-14-yl]propanoate |
| SMILES | COC(=O)CCC1C=CC[C@]23[C@@H]4C=CC[C@@]2(C)C=CC(=O)[C@]13OC4 |
| InChI | InChI=1S/C20H24O4/c1-18-10-3-6-15-13-24-20(16(21)9-12-18)14(7-8-17(22)23-2)5-4-11-19(15,18)20/h3-6,9,12,14-15H,7-8,10-11,13H2,1-2H3/t14?,15-,18+,19+,20-/m1/s1 |
| InChIKey | ATPATJGHQWNZOX-PHBYWZJISA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|