About methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate
methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate (PubChem CID 10958456) has the molecular formula C22H19NO2
and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate |
| PubChem CID | 10958456 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccn2)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO2/c1-25-20(24)22(19-14-8-9-15-23-19)16-21(22,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15H,16H2,1H3/t22-/m1/s1 |
| InChIKey | ZISPSAQAPYNUDH-JOCHJYFZSA-N |
| XLogP | 3.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate?
The IUPAC name of methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate (CID 10958456) is methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate?
The canonical SMILES for methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate is COC(=O)[C@]1(c2ccccn2)CC1(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate?
The InChIKey is ZISPSAQAPYNUDH-JOCHJYFZSA-N. The full InChI is InChI=1S/C22H19NO2/c1-25-20(24)22(19-14-8-9-15-23-19)16-21(22,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15H,16H2,1H3/t22-/m1/s1.
What are the key properties of methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate?
methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate has a molecular weight of 329.40 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-2,2-diphenyl-1-pyridin-2-ylcyclopropane-1-carboxylate is sourced from PubChem (CID 10958456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).