About tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane
tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane (PubChem CID 10958769) has the molecular formula C18H26F2O2Si
and a molecular weight of 340.49 g/mol. Its IUPAC name is tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane |
| PubChem CID | 10958769 |
| Molecular Formula | C18H26F2O2Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(C#CC(F)F)COCc1ccccc1 |
| InChI | InChI=1S/C18H26F2O2Si/c1-18(2,3)23(4,5)22-16(11-12-17(19)20)14-21-13-15-9-7-6-8-10-15/h6-10,16-17H,13-14H2,1-5H3 |
| InChIKey | JBMUTQLZIPJBEC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane?
The IUPAC name of tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane (CID 10958769) is tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane?
The canonical SMILES for tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane is CC(C)(C)[Si](C)(C)OC(C#CC(F)F)COCc1ccccc1.
What is the InChIKey of tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane?
The InChIKey is JBMUTQLZIPJBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F2O2Si/c1-18(2,3)23(4,5)22-16(11-12-17(19)20)14-21-13-15-9-7-6-8-10-15/h6-10,16-17H,13-14H2,1-5H3.
What are the key properties of tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane?
tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane has a molecular weight of 340.49 g/mol, XLogP of 4.86, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(5,5-difluoro-1-phenylmethoxypent-3-yn-2-yl)oxy-dimethylsilane is sourced from PubChem (CID 10958769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).