C23H19NO2 — CID 10958793
(1S,3R,4S)-1-methoxy-3,4-diphenyl-1,4-dihydroisochromene-3-carbonitrile (PubChem CID 10958793) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is (1S,3R,4S)-1-methoxy-3,4-diphenyl-1,4-dihydroisochromene-3-carbonitrile.
| Compound Name | (1S,3R,4S)-1-methoxy-3,4-diphenyl-1,4-dihydroisochromene-3-carbonitrile |
|---|---|
| PubChem CID | 10958793 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (1S,3R,4S)-1-methoxy-3,4-diphenyl-1,4-dihydroisochromene-3-carbonitrile |
| SMILES | CO[C@H]1O[C@@](C#N)(c2ccccc2)[C@@H](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H19NO2/c1-25-22-20-15-9-8-14-19(20)21(17-10-4-2-5-11-17)23(16-24,26-22)18-12-6-3-7-13-18/h2-15,21-22H,1H3/t21-,22-,23-/m0/s1 |
| InChIKey | CJPJTGABGASSBL-VABKMULXSA-N |
| XLogP | 4.91 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |