About 5-chloro-2,4,6-triphenylpyrimidine
5-chloro-2,4,6-triphenylpyrimidine (PubChem CID 10958822) has the molecular formula C22H15ClN2
and a molecular weight of 342.83 g/mol. Its IUPAC name is 5-chloro-2,4,6-triphenylpyrimidine.
Molecular Properties
| Compound Name | 5-chloro-2,4,6-triphenylpyrimidine |
| PubChem CID | 10958822 |
| Molecular Formula | C22H15ClN2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5-chloro-2,4,6-triphenylpyrimidine |
| SMILES | Clc1c(-c2ccccc2)nc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H15ClN2/c23-19-20(16-10-4-1-5-11-16)24-22(18-14-8-3-9-15-18)25-21(19)17-12-6-2-7-13-17/h1-15H |
| InChIKey | PLEAAWRWIMFGAN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2,4,6-triphenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4,6-triphenylpyrimidine?
The IUPAC name of 5-chloro-2,4,6-triphenylpyrimidine (CID 10958822) is 5-chloro-2,4,6-triphenylpyrimidine.
What is the SMILES notation for 5-chloro-2,4,6-triphenylpyrimidine?
The canonical SMILES for 5-chloro-2,4,6-triphenylpyrimidine is Clc1c(-c2ccccc2)nc(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of 5-chloro-2,4,6-triphenylpyrimidine?
The InChIKey is PLEAAWRWIMFGAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClN2/c23-19-20(16-10-4-1-5-11-16)24-22(18-14-8-3-9-15-18)25-21(19)17-12-6-2-7-13-17/h1-15H.
What are the key properties of 5-chloro-2,4,6-triphenylpyrimidine?
5-chloro-2,4,6-triphenylpyrimidine has a molecular weight of 342.83 g/mol, XLogP of 6.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4,6-triphenylpyrimidine is sourced from PubChem (CID 10958822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).