About CID 10958852
CID 10958852 (PubChem CID 10958852) has the molecular formula C19H24Zr+2
and a molecular weight of 343.62 g/mol.
Molecular Properties
| Compound Name | CID 10958852 |
| PubChem CID | 10958852 |
| Molecular Formula | C19H24Zr+2 |
| Molecular Weight | 343.62 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | — |
| SMILES | [CH2-][C@H]1/C(=[C-]/C)CC[C@@H]1C.[CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Zr+4] |
| InChI | InChI=1S/C9H14.2C5H5.Zr/c1-4-9-6-5-7(2)8(9)3;2*1-2-4-5-3-1;/h7-8H,3,5-6H2,1-2H3;2*1-5H;/q-2;;;+4/t7-,8+;;;/m0.../s1 |
| InChIKey | HJWGJTQLVFQQCP-WCZHJHOJSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 10958852 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10958852?
The IUPAC name of CID 10958852 (CID 10958852) is not available.
What is the SMILES notation for CID 10958852?
The canonical SMILES for CID 10958852 is [CH2-][C@H]1/C(=[C-]/C)CC[C@@H]1C.[CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Zr+4].
What is the InChIKey of CID 10958852?
The InChIKey is HJWGJTQLVFQQCP-WCZHJHOJSA-N. The full InChI is InChI=1S/C9H14.2C5H5.Zr/c1-4-9-6-5-7(2)8(9)3;2*1-2-4-5-3-1;/h7-8H,3,5-6H2,1-2H3;2*1-5H;/q-2;;;+4/t7-,8+;;;/m0.../s1.
What are the key properties of CID 10958852?
CID 10958852 has a molecular weight of 343.62 g/mol, XLogP of 4.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10958852 is sourced from PubChem (CID 10958852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).