About octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate
octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate (PubChem CID 10958944) has the molecular formula C21H30O4
and a molecular weight of 346.47 g/mol. Its IUPAC name is octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate.
Molecular Properties
| Compound Name | octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
| PubChem CID | 10958944 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate |
| SMILES | CCCCCCCCOC(=O)C12C=CC(=O)C(O)=C1CC(C)=C(C)C2 |
| InChI | InChI=1S/C21H30O4/c1-4-5-6-7-8-9-12-25-20(24)21-11-10-18(22)19(23)17(21)13-15(2)16(3)14-21/h10-11,23H,4-9,12-14H2,1-3H3 |
| InChIKey | WZKXFJBZLAENMM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate?
The IUPAC name of octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate (CID 10958944) is octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate.
What is the SMILES notation for octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate?
The canonical SMILES for octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate is CCCCCCCCOC(=O)C12C=CC(=O)C(O)=C1CC(C)=C(C)C2.
What is the InChIKey of octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate?
The InChIKey is WZKXFJBZLAENMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O4/c1-4-5-6-7-8-9-12-25-20(24)21-11-10-18(22)19(23)17(21)13-15(2)16(3)14-21/h10-11,23H,4-9,12-14H2,1-3H3.
What are the key properties of octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate?
octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate has a molecular weight of 346.47 g/mol, XLogP of 4.96, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 8-hydroxy-2,3-dimethyl-7-oxo-1,4-dihydronaphthalene-4a-carboxylate is sourced from PubChem (CID 10958944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).