C21H30O2S — CID 10958949
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene (PubChem CID 10958949) has the molecular formula C21H30O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene.
| Compound Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 10958949 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H30O2S/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-24(22,23)21-14-6-5-7-15-21/h5-7,10,12,14-16H,8-9,11,13,17H2,1-4H3/b19-12+,20-16+ |
| InChIKey | MLMQYHDLGZNPKC-YEFHWUCQSA-N |
| XLogP | 5.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|