About 1-fluoro-2,3-diiodobenzene
1-fluoro-2,3-diiodobenzene (PubChem CID 10958978) has the molecular formula C6H3FI2
and a molecular weight of 347.90 g/mol. Its IUPAC name is 1-fluoro-2,3-diiodobenzene.
Molecular Properties
| Compound Name | 1-fluoro-2,3-diiodobenzene |
| PubChem CID | 10958978 |
| Molecular Formula | C6H3FI2 |
| Molecular Weight | 347.90 g/mol |
| Exact Mass | 347.83 |
| IUPAC Name | 1-fluoro-2,3-diiodobenzene |
| SMILES | Fc1cccc(I)c1I |
| InChI | InChI=1S/C6H3FI2/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| InChIKey | JYFUOBSQTCVCGQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.90 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2,3-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,3-diiodobenzene?
The IUPAC name of 1-fluoro-2,3-diiodobenzene (CID 10958978) is 1-fluoro-2,3-diiodobenzene.
What is the SMILES notation for 1-fluoro-2,3-diiodobenzene?
The canonical SMILES for 1-fluoro-2,3-diiodobenzene is Fc1cccc(I)c1I.
What is the InChIKey of 1-fluoro-2,3-diiodobenzene?
The InChIKey is JYFUOBSQTCVCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3FI2/c7-4-2-1-3-5(8)6(4)9/h1-3H.
What are the key properties of 1-fluoro-2,3-diiodobenzene?
1-fluoro-2,3-diiodobenzene has a molecular weight of 347.90 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,3-diiodobenzene is sourced from PubChem (CID 10958978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).