C21H32O4 — CID 10959004
(1S,3R,4R,7S,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one (PubChem CID 10959004) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1S,3R,4R,7S,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one.
| Compound Name | (1S,3R,4R,7S,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one |
|---|---|
| PubChem CID | 10959004 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1S,3R,4R,7S,8R,11S)-8-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one |
| SMILES | CO[C@@H]1O[C@H]2OC(=O)[C@H](CC/C=C(\C)CCC=C(C)C)[C@H]3CC[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C21H32O4/c1-13(2)7-5-8-14(3)9-6-10-16-15-11-12-17-18(15)21(24-19(16)22)25-20(17)23-4/h7,9,15-18,20-21H,5-6,8,10-12H2,1-4H3/b14-9+/t15-,16-,17-,18+,20-,21-/m1/s1 |
| InChIKey | UWYIFKAVHKSGCW-KALLKKIBSA-N |
| XLogP | 4.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|