C20H31NO2S — CID 10959028
2,4,6-trimethyl-N-[(3S)-2-methyldeca-4,5-dien-3-yl]benzenesulfonamide (PubChem CID 10959028) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[(3S)-2-methyldeca-4,5-dien-3-yl]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[(3S)-2-methyldeca-4,5-dien-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10959028 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 2,4,6-trimethyl-N-[(3S)-2-methyldeca-4,5-dien-3-yl]benzenesulfonamide |
| SMILES | CCCCC=C=C[C@@H](NS(=O)(=O)c1c(C)cc(C)cc1C)C(C)C |
| InChI | InChI=1S/C20H31NO2S/c1-7-8-9-10-11-12-19(15(2)3)21-24(22,23)20-17(5)13-16(4)14-18(20)6/h10,12-15,19,21H,7-9H2,1-6H3/t11?,19-/m1/s1 |
| InChIKey | IXBOUCJWFWMEKH-IMFVZPHKSA-N |
| XLogP | 4.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|