About CID 10959052
CID 10959052 (PubChem CID 10959052) has the molecular formula C20H30O5
and a molecular weight of 350.46 g/mol.
Molecular Properties
| Compound Name | CID 10959052 |
| PubChem CID | 10959052 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | — |
| SMILES | COC(C)(C)[C@@H]1OC2(CC[C@@H]3C2=CC(=O)C32CC2)O[C@H]1C(C)(C)OC |
| InChI | InChI=1S/C20H30O5/c1-17(2,22-5)15-16(18(3,4)23-6)25-20(24-15)8-7-12-13(20)11-14(21)19(12)9-10-19/h11-12,15-16H,7-10H2,1-6H3/t12-,15-,16-/m1/s1 |
| InChIKey | XHJWFEVZHSQIDN-DAXOMENPSA-N |
| XLogP | 3.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 10959052 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10959052?
The IUPAC name of CID 10959052 (CID 10959052) is not available.
What is the SMILES notation for CID 10959052?
The canonical SMILES for CID 10959052 is COC(C)(C)[C@@H]1OC2(CC[C@@H]3C2=CC(=O)C32CC2)O[C@H]1C(C)(C)OC.
What is the InChIKey of CID 10959052?
The InChIKey is XHJWFEVZHSQIDN-DAXOMENPSA-N. The full InChI is InChI=1S/C20H30O5/c1-17(2,22-5)15-16(18(3,4)23-6)25-20(24-15)8-7-12-13(20)11-14(21)19(12)9-10-19/h11-12,15-16H,7-10H2,1-6H3/t12-,15-,16-/m1/s1.
What are the key properties of CID 10959052?
CID 10959052 has a molecular weight of 350.46 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10959052 is sourced from PubChem (CID 10959052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).