C20H33NO4 — CID 10959092
tert-butyl (1S,2R,4S,6S,7R)-4-[(1S)-1-hydroxybut-3-enyl]-7,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]decane-5-carboxylate (PubChem CID 10959092) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl (1S,2R,4S,6S,7R)-4-[(1S)-1-hydroxybut-3-enyl]-7,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]decane-5-carboxylate.
| Compound Name | tert-butyl (1S,2R,4S,6S,7R)-4-[(1S)-1-hydroxybut-3-enyl]-7,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]decane-5-carboxylate |
|---|---|
| PubChem CID | 10959092 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl (1S,2R,4S,6S,7R)-4-[(1S)-1-hydroxybut-3-enyl]-7,10,10-trimethyl-3-oxa-5-azatricyclo[5.2.1.02,6]decane-5-carboxylate |
| SMILES | C=CC[C@H](O)[C@@H]1O[C@@H]2[C@H]3CC[C@@](C)([C@@H]2N1C(=O)OC(C)(C)C)C3(C)C |
| InChI | InChI=1S/C20H33NO4/c1-8-9-13(22)16-21(17(23)25-18(2,3)4)15-14(24-16)12-10-11-20(15,7)19(12,5)6/h8,12-16,22H,1,9-11H2,2-7H3/t12-,13+,14-,15-,16+,20+/m1/s1 |
| InChIKey | SMVWFRGDKLXIBN-WWAUJOCVSA-N |
| XLogP | 3.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|