C17H30O6Si — CID 10959295
dimethyl 2-[(E)-4-acetyloxy-2-[tert-butyl(dimethyl)silyl]but-2-enyl]propanedioate (PubChem CID 10959295) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is dimethyl 2-[(E)-4-acetyloxy-2-[tert-butyl(dimethyl)silyl]but-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E)-4-acetyloxy-2-[tert-butyl(dimethyl)silyl]but-2-enyl]propanedioate |
|---|---|
| PubChem CID | 10959295 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | dimethyl 2-[(E)-4-acetyloxy-2-[tert-butyl(dimethyl)silyl]but-2-enyl]propanedioate |
| SMILES | COC(=O)C(C/C(=C\COC(C)=O)[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C17H30O6Si/c1-12(18)23-10-9-13(24(7,8)17(2,3)4)11-14(15(19)21-5)16(20)22-6/h9,14H,10-11H2,1-8H3/b13-9+ |
| InChIKey | KASMBDCYNFVYNY-UKTHLTGXSA-N |
| XLogP | 2.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|