C18H34O5Si — CID 10959299
[(3aR,4S,6R,6aS)-4-ethenyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10959299) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is [(3aR,4S,6R,6aS)-4-ethenyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,6R,6aS)-4-ethenyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10959299 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | [(3aR,4S,6R,6aS)-4-ethenyl-4-methoxy-2,2,6-trimethyl-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@]1(OC)O[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H34O5Si/c1-11-18(19-8)14-13(21-16(5,6)22-14)17(7,23-18)12-20-24(9,10)15(2,3)4/h11,13-14H,1,12H2,2-10H3/t13-,14+,17+,18-/m0/s1 |
| InChIKey | SZXOYTIVKQDVEG-JFTQMJAMSA-N |
| XLogP | 3.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|