About (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine
(2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine (PubChem CID 10959323) has the molecular formula C24H25NO2
and a molecular weight of 359.47 g/mol. Its IUPAC name is (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine.
Molecular Properties
| Compound Name | (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine |
| PubChem CID | 10959323 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine |
| SMILES | C(=N/Cc1ccccc1)\[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H25NO2/c1-4-10-21(11-5-1)16-25-17-24(27-19-23-14-8-3-9-15-23)20-26-18-22-12-6-2-7-13-22/h1-15,17,24H,16,18-20H2/b25-17+/t24-/m0/s1 |
| InChIKey | RIOGPVPHLUXYIR-IOCYEQIYSA-N |
| XLogP | 5.06 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine?
The IUPAC name of (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine (CID 10959323) is (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine.
What is the SMILES notation for (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine?
The canonical SMILES for (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine is C(=N/Cc1ccccc1)\[C@@H](COCc1ccccc1)OCc1ccccc1.
What is the InChIKey of (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine?
The InChIKey is RIOGPVPHLUXYIR-IOCYEQIYSA-N. The full InChI is InChI=1S/C24H25NO2/c1-4-10-21(11-5-1)16-25-17-24(27-19-23-14-8-3-9-15-23)20-26-18-22-12-6-2-7-13-22/h1-15,17,24H,16,18-20H2/b25-17+/t24-/m0/s1.
What are the key properties of (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine?
(2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine has a molecular weight of 359.47 g/mol, XLogP of 5.06, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-benzyl-2,3-bis(phenylmethoxy)propan-1-imine is sourced from PubChem (CID 10959323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).