C18H40O3Si2 — CID 10959361
(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trimethylsilyloxyheptanal (PubChem CID 10959361) has the molecular formula C18H40O3Si2 and a molecular weight of 360.69 g/mol. Its IUPAC name is (2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trimethylsilyloxyheptanal.
| Compound Name | (2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trimethylsilyloxyheptanal |
|---|---|
| PubChem CID | 10959361 |
| Molecular Formula | C18H40O3Si2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trimethylsilyloxyheptanal |
| SMILES | CCC(O[Si](C)(C)C)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C18H40O3Si2/c1-12-16(20-22(7,8)9)15(3)17(14(2)13-19)21-23(10,11)18(4,5)6/h13-17H,12H2,1-11H3/t14-,15+,16?,17-/m0/s1 |
| InChIKey | IHRMVNZCOJRUHX-WFVVYAPDSA-N |
| XLogP | 5.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|