C21H19N3O3 — CID 10959370
methyl (2Z)-2-[(4S)-4-(1H-indol-2-ylmethyl)-2-oxo-3,4-dihydro-1H-1,3-benzodiazepin-5-ylidene]acetate (PubChem CID 10959370) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is methyl (2Z)-2-[(4S)-4-(1H-indol-2-ylmethyl)-2-oxo-3,4-dihydro-1H-1,3-benzodiazepin-5-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(4S)-4-(1H-indol-2-ylmethyl)-2-oxo-3,4-dihydro-1H-1,3-benzodiazepin-5-ylidene]acetate |
|---|---|
| PubChem CID | 10959370 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | methyl (2Z)-2-[(4S)-4-(1H-indol-2-ylmethyl)-2-oxo-3,4-dihydro-1H-1,3-benzodiazepin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/c2ccccc2NC(=O)N[C@H]1Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H19N3O3/c1-27-20(25)12-16-15-7-3-5-9-18(15)23-21(26)24-19(16)11-14-10-13-6-2-4-8-17(13)22-14/h2-10,12,19,22H,11H2,1H3,(H2,23,24,26)/b16-12-/t19-/m0/s1 |
| InChIKey | BVHZWSQUJVDURA-UIRWJGRMSA-N |
| XLogP | 3.47 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|