C22H34O4 — CID 10959403
[(5E,11E)-6,12-dimethyl-2,15-dioxo-9-prop-1-en-2-ylpentadeca-5,11-dien-7-yl] acetate (PubChem CID 10959403) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(5E,11E)-6,12-dimethyl-2,15-dioxo-9-prop-1-en-2-ylpentadeca-5,11-dien-7-yl] acetate.
| Compound Name | [(5E,11E)-6,12-dimethyl-2,15-dioxo-9-prop-1-en-2-ylpentadeca-5,11-dien-7-yl] acetate |
|---|---|
| PubChem CID | 10959403 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(5E,11E)-6,12-dimethyl-2,15-dioxo-9-prop-1-en-2-ylpentadeca-5,11-dien-7-yl] acetate |
| SMILES | C=C(C)C(C/C=C(\C)CCC=O)CC(OC(C)=O)/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C22H34O4/c1-16(2)21(13-12-17(3)9-8-14-23)15-22(26-20(6)25)18(4)10-7-11-19(5)24/h10,12,14,21-22H,1,7-9,11,13,15H2,2-6H3/b17-12+,18-10+ |
| InChIKey | ULJGZIQWYSXYII-UJTOSYCASA-N |
| XLogP | 5.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|