C20H36O4Si — CID 10959570
(4aR,6S,8aR)-2,2-ditert-butyl-6-cyclohexyloxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline (PubChem CID 10959570) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (4aR,6S,8aR)-2,2-ditert-butyl-6-cyclohexyloxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline.
| Compound Name | (4aR,6S,8aR)-2,2-ditert-butyl-6-cyclohexyloxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline |
|---|---|
| PubChem CID | 10959570 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (4aR,6S,8aR)-2,2-ditert-butyl-6-cyclohexyloxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasiline |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@H](OC3CCCCC3)C=C[C@H]2O1 |
| InChI | InChI=1S/C20H36O4Si/c1-19(2,3)25(20(4,5)6)21-14-17-16(24-25)12-13-18(23-17)22-15-10-8-7-9-11-15/h12-13,15-18H,7-11,14H2,1-6H3/t16-,17-,18+/m1/s1 |
| InChIKey | JCRDFAQLCFRGFI-KURKYZTESA-N |
| XLogP | 5.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|