C19H32O7 — CID 10959672
(3S,3aR,7aR)-3-[(1R)-4-hydroxy-1-(methoxymethoxy)butyl]-3a-(methoxymethoxymethyl)-3,6-dimethyl-5,7a-dihydro-4H-1-benzofuran-2-one (PubChem CID 10959672) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-[(1R)-4-hydroxy-1-(methoxymethoxy)butyl]-3a-(methoxymethoxymethyl)-3,6-dimethyl-5,7a-dihydro-4H-1-benzofuran-2-one.
| Compound Name | (3S,3aR,7aR)-3-[(1R)-4-hydroxy-1-(methoxymethoxy)butyl]-3a-(methoxymethoxymethyl)-3,6-dimethyl-5,7a-dihydro-4H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 10959672 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (3S,3aR,7aR)-3-[(1R)-4-hydroxy-1-(methoxymethoxy)butyl]-3a-(methoxymethoxymethyl)-3,6-dimethyl-5,7a-dihydro-4H-1-benzofuran-2-one |
| SMILES | COCOC[C@]12CCC(C)=C[C@H]1OC(=O)[C@]2(C)[C@@H](CCCO)OCOC |
| InChI | InChI=1S/C19H32O7/c1-14-7-8-19(11-24-12-22-3)16(10-14)26-17(21)18(19,2)15(6-5-9-20)25-13-23-4/h10,15-16,20H,5-9,11-13H2,1-4H3/t15-,16-,18+,19-/m1/s1 |
| InChIKey | PTVBKKLKPOOOIC-ZAWLATJESA-N |
| XLogP | 2.03 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|