C26H30O2 — CID 10959716
(2S,4S,7S)-13-(cyclohexen-1-yl)-14-hydroxy-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one (PubChem CID 10959716) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is (2S,4S,7S)-13-(cyclohexen-1-yl)-14-hydroxy-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one.
| Compound Name | (2S,4S,7S)-13-(cyclohexen-1-yl)-14-hydroxy-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one |
|---|---|
| PubChem CID | 10959716 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (2S,4S,7S)-13-(cyclohexen-1-yl)-14-hydroxy-4,7-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadeca-1(10),11,13,15-tetraen-6-one |
| SMILES | C[C@]12CC(=O)[C@@]3(C)CCC4=C(CCc5cc(O)c(C6=CCCCC6)cc54)[C@]13C2 |
| InChI | InChI=1S/C26H30O2/c1-24-14-23(28)25(2)11-10-18-19-13-20(16-6-4-3-5-7-16)22(27)12-17(19)8-9-21(18)26(24,25)15-24/h6,12-13,27H,3-5,7-11,14-15H2,1-2H3/t24-,25-,26-/m1/s1 |
| InChIKey | SJFAADGRHRYGBD-TWJOJJKGSA-N |
| XLogP | 6.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |