C13H16INO2S — CID 10959783
[(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] acetate (PubChem CID 10959783) has the molecular formula C13H16INO2S and a molecular weight of 377.25 g/mol. Its IUPAC name is [(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] acetate.
| Compound Name | [(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] acetate |
|---|---|
| PubChem CID | 10959783 |
| Molecular Formula | C13H16INO2S |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | [(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hexa-1,5-dien-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](C/C=C\I)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C13H16INO2S/c1-9(7-12-8-18-10(2)15-12)13(5-4-6-14)17-11(3)16/h4,6-8,13H,5H2,1-3H3/b6-4-,9-7+/t13-/m0/s1 |
| InChIKey | MNJCONLUQAFTLK-ZSDISPMSSA-N |
| XLogP | 4.13 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|