C23H42O2Si — CID 10959821
[(3R,3aS,5aR,6S,9aS)-3-(4-methylpent-3-enyl)-1,3,3a,4,5,5a,6,7,8,9-decahydroindeno[1,7a-c]furan-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10959821) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is [(3R,3aS,5aR,6S,9aS)-3-(4-methylpent-3-enyl)-1,3,3a,4,5,5a,6,7,8,9-decahydroindeno[1,7a-c]furan-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,3aS,5aR,6S,9aS)-3-(4-methylpent-3-enyl)-1,3,3a,4,5,5a,6,7,8,9-decahydroindeno[1,7a-c]furan-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10959821 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | [(3R,3aS,5aR,6S,9aS)-3-(4-methylpent-3-enyl)-1,3,3a,4,5,5a,6,7,8,9-decahydroindeno[1,7a-c]furan-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)=CCC[C@H]1OC[C@]23CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC[C@H]13 |
| InChI | InChI=1S/C23H42O2Si/c1-17(2)10-8-11-20-18-13-14-19-21(25-26(6,7)22(3,4)5)12-9-15-23(18,19)16-24-20/h10,18-21H,8-9,11-16H2,1-7H3/t18-,19+,20-,21+,23+/m1/s1 |
| InChIKey | YNGYVDAYZMSMJH-YBNCXLCVSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|