C17H31ClO5Si — CID 10959827
(2S,3aR,7aR)-2-chloro-2-[4-(methoxymethoxy)butyl]-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one (PubChem CID 10959827) has the molecular formula C17H31ClO5Si and a molecular weight of 378.97 g/mol. Its IUPAC name is (2S,3aR,7aR)-2-chloro-2-[4-(methoxymethoxy)butyl]-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one.
| Compound Name | (2S,3aR,7aR)-2-chloro-2-[4-(methoxymethoxy)butyl]-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one |
|---|---|
| PubChem CID | 10959827 |
| Molecular Formula | C17H31ClO5Si |
| Molecular Weight | 378.97 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (2S,3aR,7aR)-2-chloro-2-[4-(methoxymethoxy)butyl]-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one |
| SMILES | COCOCCCC[C@@]1(Cl)O[C@@H]2CCCC[C@]2(O[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C17H31ClO5Si/c1-20-13-21-12-8-7-11-17(18)15(19)16(23-24(2,3)4)10-6-5-9-14(16)22-17/h14H,5-13H2,1-4H3/t14-,16-,17-/m1/s1 |
| InChIKey | GIYFMNBHMBVGDZ-DJIMGWMZSA-N |
| XLogP | 3.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|