About 6-hexylsulfonyl-3,4-diphenylpyridazine
6-hexylsulfonyl-3,4-diphenylpyridazine (PubChem CID 10959870) has the molecular formula C22H24N2O2S
and a molecular weight of 380.51 g/mol. Its IUPAC name is 6-hexylsulfonyl-3,4-diphenylpyridazine.
Molecular Properties
| Compound Name | 6-hexylsulfonyl-3,4-diphenylpyridazine |
| PubChem CID | 10959870 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 6-hexylsulfonyl-3,4-diphenylpyridazine |
| SMILES | CCCCCCS(=O)(=O)c1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C22H24N2O2S/c1-2-3-4-11-16-27(25,26)21-17-20(18-12-7-5-8-13-18)22(24-23-21)19-14-9-6-10-15-19/h5-10,12-15,17H,2-4,11,16H2,1H3 |
| InChIKey | TZMHWABYBJSOTM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hexylsulfonyl-3,4-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hexylsulfonyl-3,4-diphenylpyridazine?
The IUPAC name of 6-hexylsulfonyl-3,4-diphenylpyridazine (CID 10959870) is 6-hexylsulfonyl-3,4-diphenylpyridazine.
What is the SMILES notation for 6-hexylsulfonyl-3,4-diphenylpyridazine?
The canonical SMILES for 6-hexylsulfonyl-3,4-diphenylpyridazine is CCCCCCS(=O)(=O)c1cc(-c2ccccc2)c(-c2ccccc2)nn1.
What is the InChIKey of 6-hexylsulfonyl-3,4-diphenylpyridazine?
The InChIKey is TZMHWABYBJSOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2S/c1-2-3-4-11-16-27(25,26)21-17-20(18-12-7-5-8-13-18)22(24-23-21)19-14-9-6-10-15-19/h5-10,12-15,17H,2-4,11,16H2,1H3.
What are the key properties of 6-hexylsulfonyl-3,4-diphenylpyridazine?
6-hexylsulfonyl-3,4-diphenylpyridazine has a molecular weight of 380.51 g/mol, XLogP of 5.16, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hexylsulfonyl-3,4-diphenylpyridazine is sourced from PubChem (CID 10959870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).