C24H31NO3 — CID 10959894
[2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] benzoate (PubChem CID 10959894) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is [2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] benzoate.
| Compound Name | [2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] benzoate |
|---|---|
| PubChem CID | 10959894 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [2-phenyl-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] benzoate |
| SMILES | CC1(C)CCCC(C)(C)N1OC(COC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO3/c1-23(2)16-11-17-24(3,4)25(23)28-21(19-12-7-5-8-13-19)18-27-22(26)20-14-9-6-10-15-20/h5-10,12-15,21H,11,16-18H2,1-4H3 |
| InChIKey | OQLPQGIHIIPBCG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |