C15H36O6Si3 — CID 10960278
1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane (PubChem CID 10960278) has the molecular formula C15H36O6Si3 and a molecular weight of 396.71 g/mol. Its IUPAC name is 1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane.
| Compound Name | 1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane |
|---|---|
| PubChem CID | 10960278 |
| Molecular Formula | C15H36O6Si3 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1,1,3,3,5,5-hexaethoxy-1,3,5-trisilinane |
| SMILES | CCO[Si]1(OCC)C[Si](OCC)(OCC)C[Si](OCC)(OCC)C1 |
| InChI | InChI=1S/C15H36O6Si3/c1-7-16-22(17-8-2)13-23(18-9-3,19-10-4)15-24(14-22,20-11-5)21-12-6/h7-15H2,1-6H3 |
| InChIKey | SPEDTQCGQOZHQP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|