C21H40O3Si2 — CID 10960279
[(1Z,4E)-1-methoxy-5,9-dimethyl-2-(1-trimethylsilyloxyethenyl)deca-1,4,8-trienoxy]-trimethylsilane (PubChem CID 10960279) has the molecular formula C21H40O3Si2 and a molecular weight of 396.72 g/mol. Its IUPAC name is [(1Z,4E)-1-methoxy-5,9-dimethyl-2-(1-trimethylsilyloxyethenyl)deca-1,4,8-trienoxy]-trimethylsilane.
| Compound Name | [(1Z,4E)-1-methoxy-5,9-dimethyl-2-(1-trimethylsilyloxyethenyl)deca-1,4,8-trienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10960279 |
| Molecular Formula | C21H40O3Si2 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | [(1Z,4E)-1-methoxy-5,9-dimethyl-2-(1-trimethylsilyloxyethenyl)deca-1,4,8-trienoxy]-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)/C(C/C=C(\C)CCC=C(C)C)=C(/OC)O[Si](C)(C)C |
| InChI | InChI=1S/C21H40O3Si2/c1-17(2)13-12-14-18(3)15-16-20(19(4)23-25(6,7)8)21(22-5)24-26(9,10)11/h13,15H,4,12,14,16H2,1-3,5-11H3/b18-15+,21-20- |
| InChIKey | QJZBGBKKDPGWAU-MOOSWKITSA-N |
| XLogP | 7.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|