C27H18N2O2 — CID 10960411
5-(3-methylphenanthro[9,10-d]imidazol-2-yl)-2-phenylfuran-3-carbaldehyde (PubChem CID 10960411) has the molecular formula C27H18N2O2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 5-(3-methylphenanthro[9,10-d]imidazol-2-yl)-2-phenylfuran-3-carbaldehyde.
| Compound Name | 5-(3-methylphenanthro[9,10-d]imidazol-2-yl)-2-phenylfuran-3-carbaldehyde |
|---|---|
| PubChem CID | 10960411 |
| Molecular Formula | C27H18N2O2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 5-(3-methylphenanthro[9,10-d]imidazol-2-yl)-2-phenylfuran-3-carbaldehyde |
| SMILES | Cn1c(-c2cc(C=O)c(-c3ccccc3)o2)nc2c3ccccc3c3ccccc3c21 |
| InChI | InChI=1S/C27H18N2O2/c1-29-25-22-14-8-6-12-20(22)19-11-5-7-13-21(19)24(25)28-27(29)23-15-18(16-30)26(31-23)17-9-3-2-4-10-17/h2-16H,1H3 |
| InChIKey | JOQTXBDDSXUJBT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|