C22H30N2O3S — CID 10960419
4,10-dibenzyl-1-oxa-7λ6-thia-4,10-diazacyclododecane 7,7-dioxide (PubChem CID 10960419) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 4,10-dibenzyl-1-oxa-7λ6-thia-4,10-diazacyclododecane 7,7-dioxide.
| Compound Name | 4,10-dibenzyl-1-oxa-7λ6-thia-4,10-diazacyclododecane 7,7-dioxide |
|---|---|
| PubChem CID | 10960419 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4,10-dibenzyl-1-oxa-7λ6-thia-4,10-diazacyclododecane 7,7-dioxide |
| SMILES | O=S1(=O)CCN(Cc2ccccc2)CCOCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N2O3S/c25-28(26)17-13-23(19-21-7-3-1-4-8-21)11-15-27-16-12-24(14-18-28)20-22-9-5-2-6-10-22/h1-10H,11-20H2 |
| InChIKey | KWRYWAJAAKJQPY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |