About 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid
3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid (PubChem CID 10960600) has the molecular formula C27H25NO3
and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid |
| PubChem CID | 10960600 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C=C2CCN(C(=O)C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H25NO3/c29-26(25(22-9-3-1-4-10-22)23-11-5-2-6-12-23)28-16-14-20(15-17-28)18-21-8-7-13-24(19-21)27(30)31/h1-13,18-19,25H,14-17H2,(H,30,31) |
| InChIKey | XAZLELBMVFXKTE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid?
The IUPAC name of 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid (CID 10960600) is 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid.
What is the SMILES notation for 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid?
The canonical SMILES for 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid is O=C(O)c1cccc(C=C2CCN(C(=O)C(c3ccccc3)c3ccccc3)CC2)c1.
What is the InChIKey of 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid?
The InChIKey is XAZLELBMVFXKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO3/c29-26(25(22-9-3-1-4-10-22)23-11-5-2-6-12-23)28-16-14-20(15-17-28)18-21-8-7-13-24(19-21)27(30)31/h1-13,18-19,25H,14-17H2,(H,30,31).
What are the key properties of 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid?
3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid has a molecular weight of 411.50 g/mol, XLogP of 5.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2,2-diphenylacetyl)piperidin-4-ylidene]methyl]benzoic acid is sourced from PubChem (CID 10960600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).