C20H34O7Si — CID 10960649
methyl (1'R,4'R,4'aR,5'R,8'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-1',5'-dihydroxyspiro[1,3-dioxolane-2,8'-1,4,5,6,7,8a-hexahydronaphthalene]-4'a-carboxylate (PubChem CID 10960649) has the molecular formula C20H34O7Si and a molecular weight of 414.57 g/mol. Its IUPAC name is methyl (1'R,4'R,4'aR,5'R,8'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-1',5'-dihydroxyspiro[1,3-dioxolane-2,8'-1,4,5,6,7,8a-hexahydronaphthalene]-4'a-carboxylate.
| Compound Name | methyl (1'R,4'R,4'aR,5'R,8'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-1',5'-dihydroxyspiro[1,3-dioxolane-2,8'-1,4,5,6,7,8a-hexahydronaphthalene]-4'a-carboxylate |
|---|---|
| PubChem CID | 10960649 |
| Molecular Formula | C20H34O7Si |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | methyl (1'R,4'R,4'aR,5'R,8'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-1',5'-dihydroxyspiro[1,3-dioxolane-2,8'-1,4,5,6,7,8a-hexahydronaphthalene]-4'a-carboxylate |
| SMILES | COC(=O)[C@@]12[C@H](O)CCC3(OCCO3)[C@@H]1[C@H](O)C=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O7Si/c1-18(2,3)28(5,6)27-15-8-7-13(21)16-19(25-11-12-26-19)10-9-14(22)20(15,16)17(23)24-4/h7-8,13-16,21-22H,9-12H2,1-6H3/t13-,14-,15-,16+,20-/m1/s1 |
| InChIKey | IBRJQBAFJBGVKT-PEJGYKSESA-N |
| XLogP | 1.98 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|