C13H22N6 — CID 1096073
N-ethyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 1096073) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is N-ethyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1096073 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N-ethyl-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(N2CCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H22N6/c1-2-14-11-15-12(18-7-3-4-8-18)17-13(16-11)19-9-5-6-10-19/h2-10H2,1H3,(H,14,15,16,17) |
| InChIKey | ATMSQCJMOKLYRD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |