C19H34O8Si — CID 10960741
methyl (3aR,4S,5R,7R,7aR)-5-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate (PubChem CID 10960741) has the molecular formula C19H34O8Si and a molecular weight of 418.56 g/mol. Its IUPAC name is methyl (3aR,4S,5R,7R,7aR)-5-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,4S,5R,7R,7aR)-5-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 10960741 |
| Molecular Formula | C19H34O8Si |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl (3aR,4S,5R,7R,7aR)-5-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(OC(C)=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C19H34O8Si/c1-11(20)24-19(16(22)23-7)10-12(27-28(8,9)17(2,3)4)13-14(15(19)21)26-18(5,6)25-13/h12-15,21H,10H2,1-9H3/t12-,13+,14+,15+,19-/m1/s1 |
| InChIKey | XFXKDBNDFDJMLW-QWHKOUAISA-N |
| XLogP | 2.14 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|