C26H36O3Si — CID 10960866
(3R,5S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyloxan-2-one (PubChem CID 10960866) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is (3R,5S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 10960866 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (3R,5S,6S)-6-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3,5-dimethyloxan-2-one |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]([C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C26H36O3Si/c1-19-17-20(2)25(27)29-24(19)21(3)18-28-30(26(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,19-21,24H,17-18H2,1-6H3/t19-,20+,21-,24-/m0/s1 |
| InChIKey | UOXIKSDJXVEBJZ-XARGGIHNSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|