C21H44O7Si — CID 10961103
(1R,2S)-1-[(2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-4-hydroxy-2-methoxy-3,5-dimethyloxan-2-yl]propane-1,2-diol (PubChem CID 10961103) has the molecular formula C21H44O7Si and a molecular weight of 436.66 g/mol. Its IUPAC name is (1R,2S)-1-[(2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-4-hydroxy-2-methoxy-3,5-dimethyloxan-2-yl]propane-1,2-diol.
| Compound Name | (1R,2S)-1-[(2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-4-hydroxy-2-methoxy-3,5-dimethyloxan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 10961103 |
| Molecular Formula | C21H44O7Si |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | (1R,2S)-1-[(2R,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-4-hydroxy-2-methoxy-3,5-dimethyloxan-2-yl]propane-1,2-diol |
| SMILES | COC[C@@H](C[C@H]1O[C@@](OC)([C@H](O)[C@H](C)O)[C@H](C)[C@@H](O)[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O7Si/c1-13-17(11-16(12-25-7)28-29(9,10)20(4,5)6)27-21(26-8,14(2)18(13)23)19(24)15(3)22/h13-19,22-24H,11-12H2,1-10H3/t13-,14+,15-,16+,17+,18-,19+,21+/m0/s1 |
| InChIKey | GBXGOTWQSHSCBK-YJZNOEHWSA-N |
| XLogP | 2.53 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|