C23H50O4Si2 — CID 10961296
(4R,5S,6R,7R,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyl-9-trimethylsilyloxyundecan-3-one (PubChem CID 10961296) has the molecular formula C23H50O4Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is (4R,5S,6R,7R,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyl-9-trimethylsilyloxyundecan-3-one.
| Compound Name | (4R,5S,6R,7R,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyl-9-trimethylsilyloxyundecan-3-one |
|---|---|
| PubChem CID | 10961296 |
| Molecular Formula | C23H50O4Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | (4R,5S,6R,7R,8S,9R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6,8-trimethyl-9-trimethylsilyloxyundecan-3-one |
| SMILES | CCC(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CC)O[Si](C)(C)C |
| InChI | InChI=1S/C23H50O4Si2/c1-14-19(24)16(3)21(25)18(5)22(27-29(12,13)23(6,7)8)17(4)20(15-2)26-28(9,10)11/h16-18,20-22,25H,14-15H2,1-13H3/t16-,17-,18+,20+,21+,22-/m0/s1 |
| InChIKey | LZODGCNZIHSJEK-WJCRVXTFSA-N |
| XLogP | 6.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|