About [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate (PubChem CID 10961376) has the molecular formula C16H10IN3O3S
and a molecular weight of 451.25 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate |
| PubChem CID | 10961376 |
| Molecular Formula | C16H10IN3O3S |
| Molecular Weight | 451.25 g/mol |
| Exact Mass | 450.95 |
| IUPAC Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate |
| SMILES | O=C(Oc1cccnc1C(=O)Nc1nccs1)c1ccccc1I |
| InChI | InChI=1S/C16H10IN3O3S/c17-11-5-2-1-4-10(11)15(22)23-12-6-3-7-18-13(12)14(21)20-16-19-8-9-24-16/h1-9H,(H,19,20,21) |
| InChIKey | SPHRAVWTCSZJDM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate?
The IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate (CID 10961376) is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate.
What is the SMILES notation for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate?
The canonical SMILES for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate is O=C(Oc1cccnc1C(=O)Nc1nccs1)c1ccccc1I.
What is the InChIKey of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate?
The InChIKey is SPHRAVWTCSZJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10IN3O3S/c17-11-5-2-1-4-10(11)15(22)23-12-6-3-7-18-13(12)14(21)20-16-19-8-9-24-16/h1-9H,(H,19,20,21).
What are the key properties of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate?
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate has a molecular weight of 451.25 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2-iodobenzoate is sourced from PubChem (CID 10961376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).