C24H28NO6P — CID 10961493
(E,3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-diphenylphosphoryl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-imine (PubChem CID 10961493) has the molecular formula C24H28NO6P and a molecular weight of 457.46 g/mol. Its IUPAC name is (E,3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-diphenylphosphoryl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-imine.
| Compound Name | (E,3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-diphenylphosphoryl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-imine |
|---|---|
| PubChem CID | 10961493 |
| Molecular Formula | C24H28NO6P |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (E,3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-diphenylphosphoryl-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-imine |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)/C(=N\P(=O)(c3ccccc3)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C24H28NO6P/c1-23(2)27-15-18(29-23)20-19(21-22(28-20)31-24(3,4)30-21)25-32(26,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18,20-22H,15H2,1-4H3/b25-19+/t18-,20-,21-,22-/m1/s1 |
| InChIKey | HFJWDTPQLCUWOC-KGFPUVHTSA-N |
| XLogP | 3.38 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|