C26H30N4O2S — CID 10961571
(5Z)-5-[[2-(dibutylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 10961571) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is (5Z)-5-[[2-(dibutylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[2-(dibutylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10961571 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (5Z)-5-[[2-(dibutylamino)-4-phenyl-1,3-thiazol-5-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCN(CCCC)c1nc(-c2ccccc2)c(/C=C2\C(=O)N(C)C(=O)C(C#N)=C2C)s1 |
| InChI | InChI=1S/C26H30N4O2S/c1-5-7-14-30(15-8-6-2)26-28-23(19-12-10-9-11-13-19)22(33-26)16-20-18(3)21(17-27)25(32)29(4)24(20)31/h9-13,16H,5-8,14-15H2,1-4H3/b20-16- |
| InChIKey | OCWFVPFHSBILBT-SILNSSARSA-N |
| XLogP | 5.44 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|